# PubChem Compound Scraper (`azureblue/pubchem-compound-scraper`) Actor

Look up chemical compounds in PubChem by name. Returns CID, molecular formula, weight, SMILES, InChI, IUPAC name, physicochemical properties, description and synonyms.

- **URL**: https://apify.com/azureblue/pubchem-compound-scraper.md
- **Developed by:** [azureblue](https://apify.com/azureblue) (community)
- **Categories:** Developer tools
- **Stats:** 1 total users, 0 monthly users, 0.0% runs succeeded, NaN bookmarks
- **User rating**: No ratings yet

## Pricing

$7.50 / 1,000 results

This Actor is paid per event. You are not charged for the Apify platform usage, but only a fixed price for specific events.

Learn more: https://docs.apify.com/platform/actors/running/actors-in-store#pay-per-event

## What's an Apify Actor?

Actors are a software tools running on the Apify platform, for all kinds of web data extraction and automation use cases.
In Batch mode, an Actor accepts a well-defined JSON input, performs an action which can take anything from a few seconds to a few hours,
and optionally produces a well-defined JSON output, datasets with results, or files in key-value store.
In Standby mode, an Actor provides a web server which can be used as a website, API, or an MCP server.
Actors are written with capital "A".

## How to integrate an Actor?

If asked about integration, you help developers integrate Actors into their projects.
You adapt to their stack and deliver integrations that are safe, well-documented, and production-ready.
The best way to integrate Actors is as follows.

In JavaScript/TypeScript projects, use official [JavaScript/TypeScript client](https://docs.apify.com/api/client/js.md):

```bash
npm install apify-client
```

In Python projects, use official [Python client library](https://docs.apify.com/api/client/python.md):

```bash
pip install apify-client
```

In shell scripts, use [Apify CLI](https://docs.apify.com/cli/docs.md):

````bash
# MacOS / Linux
curl -fsSL https://apify.com/install-cli.sh | bash
# Windows
irm https://apify.com/install-cli.ps1 | iex
```bash

In AI frameworks, you might use the [Apify MCP server](https://docs.apify.com/platform/integrations/mcp.md).

If your project is in a different language, use the [REST API](https://docs.apify.com/api/v2.md).

For usage examples, see the [API](#api) section below.

For more details, see Apify documentation as [Markdown index](https://docs.apify.com/llms.txt) and [Markdown full-text](https://docs.apify.com/llms-full.txt).


# README

## PubChem Compound Scraper

Look up chemical compounds by name in [PubChem](https://pubchem.ncbi.nlm.nih.gov/) — the world's largest free chemistry database with 100+ million compounds. Returns CID, molecular formula, weight, SMILES, InChI, IUPAC name, physicochemical properties, description and synonyms.

### Features

- Resolves common names, synonyms, and IUPAC names to PubChem CID
- Batch mode: comma-separated list of compound names in a single run
- Configurable output fields — only fetch what you need
- Returns canonical SMILES, InChI, InChIKey, XLogP, H-bond donors/acceptors
- Optional narrative description (up to 600 chars from PubChem/MeSH)
- Optional top-10 synonyms list
- Rate-limited at 5 req/sec (PubChem public limit)

### Input

| Field | Type | Required | Default | Description |
|-------|------|----------|---------|-------------|
| `compoundName` | string | ✅ | — | Compound name(s), comma-separated for batch |
| `outputFields` | array | | `["formula","weight","smiles","description"]` | Fields to include |

**Available output fields:** `formula`, `weight`, `smiles`, `iupac`, `xlogp`, `hbond_donor`, `hbond_acceptor`, `rotatable_bonds`, `inchi`, `inchikey`, `complexity`, `description`, `synonyms`

### Output

```json
{
  "compoundName": "aspirin",
  "cid": 2244,
  "formula": "C9H8O4",
  "molecularWeight": 180.16,
  "smiles": "CC(=O)Oc1ccccc1C(=O)O",
  "iupacName": "2-acetyloxybenzoic acid",
  "inchi": "InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)",
  "inchiKey": "BSYNRYMUTXBXSQ-UHFFFAOYSA-N",
  "xlogp": 1.2,
  "hbondDonors": 1,
  "hbondAcceptors": 4,
  "description": "Aspirin is a member of the class of benzoic acids that is salicylic acid in which the hydrogen of the phenolic hydroxy group has been replaced by an acetyl group.",
  "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2244"
}
````

### Use Cases

#### 1. Drug Database Enrichment

A pharmaceutical data team inputs a list of 200 active pharmaceutical ingredients and retrieves full physicochemical profiles (formula, MW, XLogP, SMILES, InChI) in a single run — enriching their compound database for ADME modeling.

#### 2. Chemistry Education Platform

An online chemistry platform uses this actor to power compound lookup widgets — students enter a drug name and instantly see the molecular formula, 3D-ready SMILES string and IUPAC name pulled live from PubChem.

#### 3. Cheminformatics Pipeline

A bioinformatics researcher building a machine learning model for drug solubility batch-looks up 500 compound names to get their SMILES strings, XLogP values and H-bond counts — feeding directly into RDKit for descriptor calculation.

### Data Source

[PubChem PUG REST API](https://pubchem.ncbi.nlm.nih.gov/docs/pug-rest) — NCBI/NIH, no API key required.

### Pricing

Pay-per-result on Apify. 100 compounds ≈ $0.50–$1.00.

# Actor input Schema

## `compoundName` (type: `string`):

Chemical compound name to look up. Accepts common names, IUPAC names, or synonyms. Separate multiple compounds with commas. Example: 'aspirin' or 'aspirin, ibuprofen, paracetamol'.

## `outputFields` (type: `array`):

Which fields to include in the output. Available: formula, weight, smiles, iupac, xlogp, hbond\_donor, hbond\_acceptor, rotatable\_bonds, inchi, inchikey, complexity, description, synonyms.

## Actor input object example

```json
{
  "compoundName": "aspirin",
  "outputFields": [
    "formula",
    "weight",
    "smiles",
    "description"
  ]
}
```

# Actor output Schema

## `dataset` (type: `string`):

Open the run's default dataset to view, filter and export the scraped items.

# API

You can run this Actor programmatically using our API. Below are code examples in JavaScript, Python, and CLI, as well as the OpenAPI specification and MCP server setup.

## JavaScript example

```javascript
import { ApifyClient } from 'apify-client';

// Initialize the ApifyClient with your Apify API token
// Replace the '<YOUR_API_TOKEN>' with your token
const client = new ApifyClient({
    token: '<YOUR_API_TOKEN>',
});

// Prepare Actor input
const input = {};

// Run the Actor and wait for it to finish
const run = await client.actor("azureblue/pubchem-compound-scraper").call(input);

// Fetch and print Actor results from the run's dataset (if any)
console.log('Results from dataset');
console.log(`💾 Check your data here: https://console.apify.com/storage/datasets/${run.defaultDatasetId}`);
const { items } = await client.dataset(run.defaultDatasetId).listItems();
items.forEach((item) => {
    console.dir(item);
});

// 📚 Want to learn more 📖? Go to → https://docs.apify.com/api/client/js/docs

```

## Python example

```python
from apify_client import ApifyClient

# Initialize the ApifyClient with your Apify API token
# Replace '<YOUR_API_TOKEN>' with your token.
client = ApifyClient("<YOUR_API_TOKEN>")

# Prepare the Actor input
run_input = {}

# Run the Actor and wait for it to finish
run = client.actor("azureblue/pubchem-compound-scraper").call(run_input=run_input)

# Fetch and print Actor results from the run's dataset (if there are any)
print("💾 Check your data here: https://console.apify.com/storage/datasets/" + run["defaultDatasetId"])
for item in client.dataset(run["defaultDatasetId"]).iterate_items():
    print(item)

# 📚 Want to learn more 📖? Go to → https://docs.apify.com/api/client/python/docs/quick-start

```

## CLI example

```bash
echo '{}' |
apify call azureblue/pubchem-compound-scraper --silent --output-dataset

```

## MCP server setup

```json
{
    "mcpServers": {
        "apify": {
            "command": "npx",
            "args": [
                "mcp-remote",
                "https://mcp.apify.com/?tools=azureblue/pubchem-compound-scraper",
                "--header",
                "Authorization: Bearer <YOUR_API_TOKEN>"
            ]
        }
    }
}

```

## OpenAPI specification

```json
{
    "openapi": "3.0.1",
    "info": {
        "title": "PubChem Compound Scraper",
        "description": "Look up chemical compounds in PubChem by name. Returns CID, molecular formula, weight, SMILES, InChI, IUPAC name, physicochemical properties, description and synonyms.",
        "version": "1.0",
        "x-build-id": "yrd6EBaYNiCGGEOGf"
    },
    "servers": [
        {
            "url": "https://api.apify.com/v2"
        }
    ],
    "paths": {
        "/acts/azureblue~pubchem-compound-scraper/run-sync-get-dataset-items": {
            "post": {
                "operationId": "run-sync-get-dataset-items-azureblue-pubchem-compound-scraper",
                "x-openai-isConsequential": false,
                "summary": "Executes an Actor, waits for its completion, and returns Actor's dataset items in response.",
                "tags": [
                    "Run Actor"
                ],
                "requestBody": {
                    "required": true,
                    "content": {
                        "application/json": {
                            "schema": {
                                "$ref": "#/components/schemas/inputSchema"
                            }
                        }
                    }
                },
                "parameters": [
                    {
                        "name": "token",
                        "in": "query",
                        "required": true,
                        "schema": {
                            "type": "string"
                        },
                        "description": "Enter your Apify token here"
                    }
                ],
                "responses": {
                    "200": {
                        "description": "OK"
                    }
                }
            }
        },
        "/acts/azureblue~pubchem-compound-scraper/runs": {
            "post": {
                "operationId": "runs-sync-azureblue-pubchem-compound-scraper",
                "x-openai-isConsequential": false,
                "summary": "Executes an Actor and returns information about the initiated run in response.",
                "tags": [
                    "Run Actor"
                ],
                "requestBody": {
                    "required": true,
                    "content": {
                        "application/json": {
                            "schema": {
                                "$ref": "#/components/schemas/inputSchema"
                            }
                        }
                    }
                },
                "parameters": [
                    {
                        "name": "token",
                        "in": "query",
                        "required": true,
                        "schema": {
                            "type": "string"
                        },
                        "description": "Enter your Apify token here"
                    }
                ],
                "responses": {
                    "200": {
                        "description": "OK",
                        "content": {
                            "application/json": {
                                "schema": {
                                    "$ref": "#/components/schemas/runsResponseSchema"
                                }
                            }
                        }
                    }
                }
            }
        },
        "/acts/azureblue~pubchem-compound-scraper/run-sync": {
            "post": {
                "operationId": "run-sync-azureblue-pubchem-compound-scraper",
                "x-openai-isConsequential": false,
                "summary": "Executes an Actor, waits for completion, and returns the OUTPUT from Key-value store in response.",
                "tags": [
                    "Run Actor"
                ],
                "requestBody": {
                    "required": true,
                    "content": {
                        "application/json": {
                            "schema": {
                                "$ref": "#/components/schemas/inputSchema"
                            }
                        }
                    }
                },
                "parameters": [
                    {
                        "name": "token",
                        "in": "query",
                        "required": true,
                        "schema": {
                            "type": "string"
                        },
                        "description": "Enter your Apify token here"
                    }
                ],
                "responses": {
                    "200": {
                        "description": "OK"
                    }
                }
            }
        }
    },
    "components": {
        "schemas": {
            "inputSchema": {
                "type": "object",
                "required": [
                    "compoundName"
                ],
                "properties": {
                    "compoundName": {
                        "title": "Compound Name(s)",
                        "type": "string",
                        "description": "Chemical compound name to look up. Accepts common names, IUPAC names, or synonyms. Separate multiple compounds with commas. Example: 'aspirin' or 'aspirin, ibuprofen, paracetamol'."
                    },
                    "outputFields": {
                        "title": "Output Fields",
                        "type": "array",
                        "description": "Which fields to include in the output. Available: formula, weight, smiles, iupac, xlogp, hbond_donor, hbond_acceptor, rotatable_bonds, inchi, inchikey, complexity, description, synonyms.",
                        "default": [
                            "formula",
                            "weight",
                            "smiles",
                            "description"
                        ]
                    }
                }
            },
            "runsResponseSchema": {
                "type": "object",
                "properties": {
                    "data": {
                        "type": "object",
                        "properties": {
                            "id": {
                                "type": "string"
                            },
                            "actId": {
                                "type": "string"
                            },
                            "userId": {
                                "type": "string"
                            },
                            "startedAt": {
                                "type": "string",
                                "format": "date-time",
                                "example": "2025-01-08T00:00:00.000Z"
                            },
                            "finishedAt": {
                                "type": "string",
                                "format": "date-time",
                                "example": "2025-01-08T00:00:00.000Z"
                            },
                            "status": {
                                "type": "string",
                                "example": "READY"
                            },
                            "meta": {
                                "type": "object",
                                "properties": {
                                    "origin": {
                                        "type": "string",
                                        "example": "API"
                                    },
                                    "userAgent": {
                                        "type": "string"
                                    }
                                }
                            },
                            "stats": {
                                "type": "object",
                                "properties": {
                                    "inputBodyLen": {
                                        "type": "integer",
                                        "example": 2000
                                    },
                                    "rebootCount": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "restartCount": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "resurrectCount": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "computeUnits": {
                                        "type": "integer",
                                        "example": 0
                                    }
                                }
                            },
                            "options": {
                                "type": "object",
                                "properties": {
                                    "build": {
                                        "type": "string",
                                        "example": "latest"
                                    },
                                    "timeoutSecs": {
                                        "type": "integer",
                                        "example": 300
                                    },
                                    "memoryMbytes": {
                                        "type": "integer",
                                        "example": 1024
                                    },
                                    "diskMbytes": {
                                        "type": "integer",
                                        "example": 2048
                                    }
                                }
                            },
                            "buildId": {
                                "type": "string"
                            },
                            "defaultKeyValueStoreId": {
                                "type": "string"
                            },
                            "defaultDatasetId": {
                                "type": "string"
                            },
                            "defaultRequestQueueId": {
                                "type": "string"
                            },
                            "buildNumber": {
                                "type": "string",
                                "example": "1.0.0"
                            },
                            "containerUrl": {
                                "type": "string"
                            },
                            "usage": {
                                "type": "object",
                                "properties": {
                                    "ACTOR_COMPUTE_UNITS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATASET_READS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATASET_WRITES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "KEY_VALUE_STORE_READS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "KEY_VALUE_STORE_WRITES": {
                                        "type": "integer",
                                        "example": 1
                                    },
                                    "KEY_VALUE_STORE_LISTS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "REQUEST_QUEUE_READS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "REQUEST_QUEUE_WRITES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATA_TRANSFER_INTERNAL_GBYTES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATA_TRANSFER_EXTERNAL_GBYTES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "PROXY_RESIDENTIAL_TRANSFER_GBYTES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "PROXY_SERPS": {
                                        "type": "integer",
                                        "example": 0
                                    }
                                }
                            },
                            "usageTotalUsd": {
                                "type": "number",
                                "example": 0.00005
                            },
                            "usageUsd": {
                                "type": "object",
                                "properties": {
                                    "ACTOR_COMPUTE_UNITS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATASET_READS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATASET_WRITES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "KEY_VALUE_STORE_READS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "KEY_VALUE_STORE_WRITES": {
                                        "type": "number",
                                        "example": 0.00005
                                    },
                                    "KEY_VALUE_STORE_LISTS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "REQUEST_QUEUE_READS": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "REQUEST_QUEUE_WRITES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATA_TRANSFER_INTERNAL_GBYTES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "DATA_TRANSFER_EXTERNAL_GBYTES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "PROXY_RESIDENTIAL_TRANSFER_GBYTES": {
                                        "type": "integer",
                                        "example": 0
                                    },
                                    "PROXY_SERPS": {
                                        "type": "integer",
                                        "example": 0
                                    }
                                }
                            }
                        }
                    }
                }
            }
        }
    }
}
```
